About 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten
5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten (PubChem CID 166112470) has the molecular formula C10H11N2O2W-3
and a molecular weight of 375.05 g/mol. Its IUPAC name is 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten.
Molecular Properties
| Compound Name | 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten |
| PubChem CID | 166112470 |
| Molecular Formula | C10H11N2O2W-3 |
| Molecular Weight | 375.05 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten |
| SMILES | Cc1cc[c-]nc1.[CH2-]CC(=O)N[C-]=O.[W] |
| InChI | InChI=1S/C6H6N.C4H5NO2.W/c1-6-3-2-4-7-5-6;1-2-4(7)5-3-6;/h2-3,5H,1H3;1-2H2,(H,5,6,7);/q-1;-2; |
| InChIKey | KCELNFQLVOKGJL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.05 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten?
The IUPAC name of 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten (CID 166112470) is 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten.
What is the SMILES notation for 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten?
The canonical SMILES for 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten is Cc1cc[c-]nc1.[CH2-]CC(=O)N[C-]=O.[W].
What is the InChIKey of 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten?
The InChIKey is KCELNFQLVOKGJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N.C4H5NO2.W/c1-6-3-2-4-7-5-6;1-2-4(7)5-3-6;/h2-3,5H,1H3;1-2H2,(H,5,6,7);/q-1;-2;.
What are the key properties of 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten?
5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten has a molecular weight of 375.05 g/mol, XLogP of 0.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2H-pyridin-2-ide;N-(oxomethyl)propanamide;tungsten is sourced from PubChem (CID 166112470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).