C15H32N4O — CID 166115367
N,N-dimethylmethanamine;1-ethyl-4-methyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde (PubChem CID 166115367) has the molecular formula C15H32N4O and a molecular weight of 284.45 g/mol. Its IUPAC name is N,N-dimethylmethanamine;1-ethyl-4-methyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde.
| Compound Name | N,N-dimethylmethanamine;1-ethyl-4-methyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde |
|---|---|
| PubChem CID | 166115367 |
| Molecular Formula | C15H32N4O |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.26 |
| IUPAC Name | N,N-dimethylmethanamine;1-ethyl-4-methyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde |
| SMILES | CCN1CCN(C)CC12CCN(C=O)CC2.CN(C)C |
| InChI | InChI=1S/C12H23N3O.C3H9N/c1-3-15-9-8-13(2)10-12(15)4-6-14(11-16)7-5-12;1-4(2)3/h11H,3-10H2,1-2H3;1-3H3 |
| InChIKey | DXOFCXGXCDHWBX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|