C31H43F3N2O — CID 166119080
(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1-[3-ethyl-4-[(3-methylazetidin-1-yl)methyl]phenyl]ethanimine;ethane (PubChem CID 166119080) has the molecular formula C31H43F3N2O and a molecular weight of 516.69 g/mol. Its IUPAC name is (E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1-[3-ethyl-4-[(3-methylazetidin-1-yl)methyl]phenyl]ethanimine;ethane.
| Compound Name | (E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1-[3-ethyl-4-[(3-methylazetidin-1-yl)methyl]phenyl]ethanimine;ethane |
|---|---|
| PubChem CID | 166119080 |
| Molecular Formula | C31H43F3N2O |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | (E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1-[3-ethyl-4-[(3-methylazetidin-1-yl)methyl]phenyl]ethanimine;ethane |
| SMILES | CC.CCc1cc(/C(C)=N/OCc2ccc(C3CCCCC3)c(C(F)(F)F)c2)ccc1CN1CC(C)C1 |
| InChI | InChI=1S/C29H37F3N2O.C2H6/c1-4-23-15-25(11-12-26(23)18-34-16-20(2)17-34)21(3)33-35-19-22-10-13-27(24-8-6-5-7-9-24)28(14-22)29(30,31)32;1-2/h10-15,20,24H,4-9,16-19H2,1-3H3;1-2H3/b33-21+; |
| InChIKey | VEEDJHXTGBRLRR-KOCUTIIDSA-N |
| XLogP | 8.73 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|