C34H34FN3O6S — CID 166119269
N-(10-ethyl-18-fluoro-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl)-3-phenylmethoxypropane-1-sulfonamide (PubChem CID 166119269) has the molecular formula C34H34FN3O6S and a molecular weight of 631.73 g/mol. Its IUPAC name is N-(10-ethyl-18-fluoro-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl)-3-phenylmethoxypropane-1-sulfonamide.
| Compound Name | N-(10-ethyl-18-fluoro-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl)-3-phenylmethoxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 166119269 |
| Molecular Formula | C34H34FN3O6S |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | N-(10-ethyl-18-fluoro-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl)-3-phenylmethoxypropane-1-sulfonamide |
| SMILES | CCC1C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)c3c1c2C(NS(=O)(=O)CCCOCc1ccccc1)CC3 |
| InChI | InChI=1S/C34H34FN3O6S/c1-3-21-23-14-29-32-24(16-38(29)33(39)25(23)18-44-34(21)40)31-27(11-10-22-19(2)26(35)15-28(36-32)30(22)31)37-45(41,42)13-7-12-43-17-20-8-5-4-6-9-20/h4-6,8-9,14-15,21,27,37H,3,7,10-13,16-18H2,1-2H3 |
| InChIKey | RJFAWRHAWNGSCN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|