C33H31FN4O6 — CID 178079960
[4-(methylaminooxy)phenyl]methyl N-(10-ethyl-18-fluoro-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl)carbamate (PubChem CID 178079960) has the molecular formula C33H31FN4O6 and a molecular weight of 598.63 g/mol. Its IUPAC name is [4-(methylaminooxy)phenyl]methyl N-(10-ethyl-18-fluoro-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl)carbamate.
| Compound Name | [4-(methylaminooxy)phenyl]methyl N-(10-ethyl-18-fluoro-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl)carbamate |
|---|---|
| PubChem CID | 178079960 |
| Molecular Formula | C33H31FN4O6 |
| Molecular Weight | 598.63 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | [4-(methylaminooxy)phenyl]methyl N-(10-ethyl-18-fluoro-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl)carbamate |
| SMILES | CCC1C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)c3c1c2C(NC(=O)OCc1ccc(ONC)cc1)CC3 |
| InChI | InChI=1S/C33H31FN4O6/c1-4-19-21-11-27-30-22(13-38(27)31(39)23(21)15-42-32(19)40)29-25(10-9-20-16(2)24(34)12-26(36-30)28(20)29)37-33(41)43-14-17-5-7-18(8-6-17)44-35-3/h5-8,11-12,19,25,35H,4,9-10,13-15H2,1-3H3,(H,37,41) |
| InChIKey | UFDDLOJKNVAGKU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|