C14H30N4 — CID 166120995
N'-[(E)-2-[[2-aminoethyl(ethyl)amino]methyl]but-1-enyl]prop-2-enimidamide;ethane (PubChem CID 166120995) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is N'-[(E)-2-[[2-aminoethyl(ethyl)amino]methyl]but-1-enyl]prop-2-enimidamide;ethane.
| Compound Name | N'-[(E)-2-[[2-aminoethyl(ethyl)amino]methyl]but-1-enyl]prop-2-enimidamide;ethane |
|---|---|
| PubChem CID | 166120995 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | N'-[(E)-2-[[2-aminoethyl(ethyl)amino]methyl]but-1-enyl]prop-2-enimidamide;ethane |
| SMILES | C=C/C(N)=N\C=C(/CC)CN(CC)CCN.CC |
| InChI | InChI=1S/C12H24N4.C2H6/c1-4-11(9-15-12(14)5-2)10-16(6-3)8-7-13;1-2/h5,9H,2,4,6-8,10,13H2,1,3H3,(H2,14,15);1-2H3/b11-9+; |
| InChIKey | LZHUYDCSFKPNQJ-LBEJWNQZSA-N |
| XLogP | 2.13 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|