C12H24N4 — CID 166120996
N'-[(E)-2-[[2-aminoethyl(ethyl)amino]methyl]but-1-enyl]prop-2-enimidamide (PubChem CID 166120996) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is N'-[(E)-2-[[2-aminoethyl(ethyl)amino]methyl]but-1-enyl]prop-2-enimidamide.
| Compound Name | N'-[(E)-2-[[2-aminoethyl(ethyl)amino]methyl]but-1-enyl]prop-2-enimidamide |
|---|---|
| PubChem CID | 166120996 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | N'-[(E)-2-[[2-aminoethyl(ethyl)amino]methyl]but-1-enyl]prop-2-enimidamide |
| SMILES | C=C/C(N)=N\C=C(/CC)CN(CC)CCN |
| InChI | InChI=1S/C12H24N4/c1-4-11(9-15-12(14)5-2)10-16(6-3)8-7-13/h5,9H,2,4,6-8,10,13H2,1,3H3,(H2,14,15)/b11-9+ |
| InChIKey | XWSIFYIFNNZXBR-PKNBQFBNSA-N |
| XLogP | 1.10 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|