C24H21ClN2O4S — CID 16612554
[2-[(5-chlorothiophen-2-yl)methyl-ethylamino]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate (PubChem CID 16612554) has the molecular formula C24H21ClN2O4S and a molecular weight of 468.96 g/mol. Its IUPAC name is [2-[(5-chlorothiophen-2-yl)methyl-ethylamino]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate.
| Compound Name | [2-[(5-chlorothiophen-2-yl)methyl-ethylamino]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
|---|---|
| PubChem CID | 16612554 |
| Molecular Formula | C24H21ClN2O4S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | [2-[(5-chlorothiophen-2-yl)methyl-ethylamino]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)COC(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C24H21ClN2O4S/c1-2-26(13-16-11-12-21(25)32-16)22(28)15-31-23(29)14-27-19-9-5-3-7-17(19)24(30)18-8-4-6-10-20(18)27/h3-12H,2,13-15H2,1H3 |
| InChIKey | INMPHLIZYDHCMA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|