C17H15ClN2O3S — CID 9201883
[2-[(5-chlorothiophen-2-yl)methyl-ethylamino]-2-oxoethyl] 4-cyanobenzoate (PubChem CID 9201883) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is [2-[(5-chlorothiophen-2-yl)methyl-ethylamino]-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-[(5-chlorothiophen-2-yl)methyl-ethylamino]-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 9201883 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | [2-[(5-chlorothiophen-2-yl)methyl-ethylamino]-2-oxoethyl] 4-cyanobenzoate |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)COC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H15ClN2O3S/c1-2-20(10-14-7-8-15(18)24-14)16(21)11-23-17(22)13-5-3-12(9-19)4-6-13/h3-8H,2,10-11H2,1H3 |
| InChIKey | OKECWOPCBFXWIU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |