C16H15N3OS — CID 166128242
2-(4-methyl-8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl)phenol (PubChem CID 166128242) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-(4-methyl-8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl)phenol.
| Compound Name | 2-(4-methyl-8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl)phenol |
|---|---|
| PubChem CID | 166128242 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-(4-methyl-8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl)phenol |
| SMILES | CN1CCc2sc3nnc(-c4ccccc4O)cc3c2C1 |
| InChI | InChI=1S/C16H15N3OS/c1-19-7-6-15-12(9-19)11-8-13(17-18-16(11)21-15)10-4-2-3-5-14(10)20/h2-5,8,20H,6-7,9H2,1H3 |
| InChIKey | AAMRTTIYZZEXNK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |