C19H11N3OS — CID 100945026
5-hydroxy-3,4-diphenylthieno[2,3-c]pyridazine-6-carbonitrile (PubChem CID 100945026) has the molecular formula C19H11N3OS and a molecular weight of 329.38 g/mol. Its IUPAC name is 5-hydroxy-3,4-diphenylthieno[2,3-c]pyridazine-6-carbonitrile.
| Compound Name | 5-hydroxy-3,4-diphenylthieno[2,3-c]pyridazine-6-carbonitrile |
|---|---|
| PubChem CID | 100945026 |
| Molecular Formula | C19H11N3OS |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 5-hydroxy-3,4-diphenylthieno[2,3-c]pyridazine-6-carbonitrile |
| SMILES | N#Cc1sc2nnc(-c3ccccc3)c(-c3ccccc3)c2c1O |
| InChI | InChI=1S/C19H11N3OS/c20-11-14-18(23)16-15(12-7-3-1-4-8-12)17(21-22-19(16)24-14)13-9-5-2-6-10-13/h1-10,23H |
| InChIKey | VCFFBSMNRCPJTN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|