C16H12BN3OS — CID 166128111
3-[3-(2-hydroxyphenyl)thieno[2,3-c]pyridazin-6-yl]boretane-1-carbonitrile (PubChem CID 166128111) has the molecular formula C16H12BN3OS and a molecular weight of 305.17 g/mol. Its IUPAC name is 3-[3-(2-hydroxyphenyl)thieno[2,3-c]pyridazin-6-yl]boretane-1-carbonitrile.
| Compound Name | 3-[3-(2-hydroxyphenyl)thieno[2,3-c]pyridazin-6-yl]boretane-1-carbonitrile |
|---|---|
| PubChem CID | 166128111 |
| Molecular Formula | C16H12BN3OS |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-[3-(2-hydroxyphenyl)thieno[2,3-c]pyridazin-6-yl]boretane-1-carbonitrile |
| SMILES | N#CB1CC(c2cc3cc(-c4ccccc4O)nnc3s2)C1 |
| InChI | InChI=1S/C16H12BN3OS/c18-9-17-7-11(8-17)15-6-10-5-13(19-20-16(10)22-15)12-3-1-2-4-14(12)21/h1-6,11,21H,7-8H2 |
| InChIKey | LNVWUAAQPFDSJB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|