C20H25Cl2N7O3 — CID 166130382
1-(2-chloro-3-pyridinyl)ethyl N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-(3-chloropropylcarbamoyl)-2-pyridinyl]ethenyl]carbamate (PubChem CID 166130382) has the molecular formula C20H25Cl2N7O3 and a molecular weight of 482.37 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)ethyl N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-(3-chloropropylcarbamoyl)-2-pyridinyl]ethenyl]carbamate.
| Compound Name | 1-(2-chloro-3-pyridinyl)ethyl N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-(3-chloropropylcarbamoyl)-2-pyridinyl]ethenyl]carbamate |
|---|---|
| PubChem CID | 166130382 |
| Molecular Formula | C20H25Cl2N7O3 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)ethyl N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-(3-chloropropylcarbamoyl)-2-pyridinyl]ethenyl]carbamate |
| SMILES | CC(OC(=O)N/C(=C(/N)c1ccc(C(=O)NCCCCl)cn1)N(C)N)c1cccnc1Cl |
| InChI | InChI=1S/C20H25Cl2N7O3/c1-12(14-5-3-9-25-17(14)22)32-20(31)28-18(29(2)24)16(23)15-7-6-13(11-27-15)19(30)26-10-4-8-21/h3,5-7,9,11-12H,4,8,10,23-24H2,1-2H3,(H,26,30)(H,28,31)/b18-16- |
| InChIKey | YTXVVXURXVHFQN-VLGSPTGOSA-N |
| XLogP | 2.37 |
| TPSA | 148.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|