C25H22ClFN4O2 — CID 166131233
(E)-N-[6-[4-[acetyl(cyclopropylmethyl)amino]-3-chlorophenyl]-3-pyridinyl]-3-(2-fluoro-3-pyridinyl)prop-2-enamide (PubChem CID 166131233) has the molecular formula C25H22ClFN4O2 and a molecular weight of 464.93 g/mol. Its IUPAC name is (E)-N-[6-[4-[acetyl(cyclopropylmethyl)amino]-3-chlorophenyl]-3-pyridinyl]-3-(2-fluoro-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-N-[6-[4-[acetyl(cyclopropylmethyl)amino]-3-chlorophenyl]-3-pyridinyl]-3-(2-fluoro-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 166131233 |
| Molecular Formula | C25H22ClFN4O2 |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (E)-N-[6-[4-[acetyl(cyclopropylmethyl)amino]-3-chlorophenyl]-3-pyridinyl]-3-(2-fluoro-3-pyridinyl)prop-2-enamide |
| SMILES | CC(=O)N(CC1CC1)c1ccc(-c2ccc(NC(=O)/C=C/c3cccnc3F)cn2)cc1Cl |
| InChI | InChI=1S/C25H22ClFN4O2/c1-16(32)31(15-17-4-5-17)23-10-6-19(13-21(23)26)22-9-8-20(14-29-22)30-24(33)11-7-18-3-2-12-28-25(18)27/h2-3,6-14,17H,4-5,15H2,1H3,(H,30,33)/b11-7+ |
| InChIKey | KSUYYDIIPOFORW-YRNVUSSQSA-N |
| XLogP | 5.35 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|