C24H21F3N4O4 — CID 166131169
methyl 2-[acetyl(2,2-difluoroethyl)amino]-5-[5-[[2-(2-fluoro-3-pyridinyl)acetyl]amino]-2-pyridinyl]benzoate (PubChem CID 166131169) has the molecular formula C24H21F3N4O4 and a molecular weight of 486.45 g/mol. Its IUPAC name is methyl 2-[acetyl(2,2-difluoroethyl)amino]-5-[5-[[2-(2-fluoro-3-pyridinyl)acetyl]amino]-2-pyridinyl]benzoate.
| Compound Name | methyl 2-[acetyl(2,2-difluoroethyl)amino]-5-[5-[[2-(2-fluoro-3-pyridinyl)acetyl]amino]-2-pyridinyl]benzoate |
|---|---|
| PubChem CID | 166131169 |
| Molecular Formula | C24H21F3N4O4 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | methyl 2-[acetyl(2,2-difluoroethyl)amino]-5-[5-[[2-(2-fluoro-3-pyridinyl)acetyl]amino]-2-pyridinyl]benzoate |
| SMILES | COC(=O)c1cc(-c2ccc(NC(=O)Cc3cccnc3F)cn2)ccc1N(CC(F)F)C(C)=O |
| InChI | InChI=1S/C24H21F3N4O4/c1-14(32)31(13-21(25)26)20-8-5-15(10-18(20)24(34)35-2)19-7-6-17(12-29-19)30-22(33)11-16-4-3-9-28-23(16)27/h3-10,12,21H,11,13H2,1-2H3,(H,30,33) |
| InChIKey | LOHMUVIUDUVFLF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|