C19H37N3O6 — CID 166131979
5-[[3-[2-(acetamidomethyl)-2-ethylbutoxy]-2,2-dimethylpropyl]amino]-2-aminooxy-5-oxopentanoic acid (PubChem CID 166131979) has the molecular formula C19H37N3O6 and a molecular weight of 403.52 g/mol. Its IUPAC name is 5-[[3-[2-(acetamidomethyl)-2-ethylbutoxy]-2,2-dimethylpropyl]amino]-2-aminooxy-5-oxopentanoic acid.
| Compound Name | 5-[[3-[2-(acetamidomethyl)-2-ethylbutoxy]-2,2-dimethylpropyl]amino]-2-aminooxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 166131979 |
| Molecular Formula | C19H37N3O6 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | 5-[[3-[2-(acetamidomethyl)-2-ethylbutoxy]-2,2-dimethylpropyl]amino]-2-aminooxy-5-oxopentanoic acid |
| SMILES | CCC(CC)(CNC(C)=O)COCC(C)(C)CNC(=O)CCC(ON)C(=O)O |
| InChI | InChI=1S/C19H37N3O6/c1-6-19(7-2,11-21-14(3)23)13-27-12-18(4,5)10-22-16(24)9-8-15(28-20)17(25)26/h15H,6-13,20H2,1-5H3,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | CKHCMAOTJGSLOI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|