C16H23FN2O5S — CID 166132844
tert-butyl (3R)-3-(3-fluorosulfonyloxyanilino)piperidine-1-carboxylate (PubChem CID 166132844) has the molecular formula C16H23FN2O5S and a molecular weight of 374.43 g/mol. Its IUPAC name is tert-butyl (3R)-3-(3-fluorosulfonyloxyanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(3-fluorosulfonyloxyanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166132844 |
| Molecular Formula | C16H23FN2O5S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | tert-butyl (3R)-3-(3-fluorosulfonyloxyanilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Nc2cccc(OS(=O)(=O)F)c2)C1 |
| InChI | InChI=1S/C16H23FN2O5S/c1-16(2,3)23-15(20)19-9-5-7-13(11-19)18-12-6-4-8-14(10-12)24-25(17,21)22/h4,6,8,10,13,18H,5,7,9,11H2,1-3H3/t13-/m1/s1 |
| InChIKey | XTFLNMJZXUJYKS-CYBMUJFWSA-N |
| XLogP | 3.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |