About (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate
(3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate (PubChem CID 166142890) has the molecular formula C17H26N2O5
and a molecular weight of 338.40 g/mol. Its IUPAC name is (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate.
Molecular Properties
| Compound Name | (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate |
| PubChem CID | 166142890 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate |
| SMILES | O=C(CCCN1CCN(CCO)CC1)OCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C17H26N2O5/c20-9-8-19-6-4-18(5-7-19)3-1-2-17(23)24-13-14-10-15(21)12-16(22)11-14/h10-12,20-22H,1-9,13H2 |
| InChIKey | OELDHUZZTXYRFD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate?
The IUPAC name of (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate (CID 166142890) is (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate.
What is the SMILES notation for (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate?
The canonical SMILES for (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate is O=C(CCCN1CCN(CCO)CC1)OCc1cc(O)cc(O)c1.
What is the InChIKey of (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate?
The InChIKey is OELDHUZZTXYRFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O5/c20-9-8-19-6-4-18(5-7-19)3-1-2-17(23)24-13-14-10-15(21)12-16(22)11-14/h10-12,20-22H,1-9,13H2.
What are the key properties of (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate?
(3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate has a molecular weight of 338.40 g/mol, XLogP of 0.53, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dihydroxyphenyl)methyl 4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoate is sourced from PubChem (CID 166142890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).