About 1-cyclopropyl-N-ethenyl-N-methylethanamine
1-cyclopropyl-N-ethenyl-N-methylethanamine (PubChem CID 166145194) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is 1-cyclopropyl-N-ethenyl-N-methylethanamine.
Molecular Properties
| Compound Name | 1-cyclopropyl-N-ethenyl-N-methylethanamine |
| PubChem CID | 166145194 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 1-cyclopropyl-N-ethenyl-N-methylethanamine |
| SMILES | C=CN(C)C(C)C1CC1 |
| InChI | InChI=1S/C8H15N/c1-4-9(3)7(2)8-5-6-8/h4,7-8H,1,5-6H2,2-3H3 |
| InChIKey | QXVQRLQRAKNGED-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropyl-N-ethenyl-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-N-ethenyl-N-methylethanamine?
The IUPAC name of 1-cyclopropyl-N-ethenyl-N-methylethanamine (CID 166145194) is 1-cyclopropyl-N-ethenyl-N-methylethanamine.
What is the SMILES notation for 1-cyclopropyl-N-ethenyl-N-methylethanamine?
The canonical SMILES for 1-cyclopropyl-N-ethenyl-N-methylethanamine is C=CN(C)C(C)C1CC1.
What is the InChIKey of 1-cyclopropyl-N-ethenyl-N-methylethanamine?
The InChIKey is QXVQRLQRAKNGED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N/c1-4-9(3)7(2)8-5-6-8/h4,7-8H,1,5-6H2,2-3H3.
What are the key properties of 1-cyclopropyl-N-ethenyl-N-methylethanamine?
1-cyclopropyl-N-ethenyl-N-methylethanamine has a molecular weight of 125.21 g/mol, XLogP of 1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-N-ethenyl-N-methylethanamine is sourced from PubChem (CID 166145194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).