C16H21BrFNO3 — CID 166147781
tert-butyl N-[(1R,2R)-2-(2-bromo-3-fluorophenoxy)cyclopentyl]carbamate (PubChem CID 166147781) has the molecular formula C16H21BrFNO3 and a molecular weight of 374.25 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-2-(2-bromo-3-fluorophenoxy)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-2-(2-bromo-3-fluorophenoxy)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 166147781 |
| Molecular Formula | C16H21BrFNO3 |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | tert-butyl N-[(1R,2R)-2-(2-bromo-3-fluorophenoxy)cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H]1Oc1cccc(F)c1Br |
| InChI | InChI=1S/C16H21BrFNO3/c1-16(2,3)22-15(20)19-11-7-5-8-12(11)21-13-9-4-6-10(18)14(13)17/h4,6,9,11-12H,5,7-8H2,1-3H3,(H,19,20)/t11-,12-/m1/s1 |
| InChIKey | FTMMRJQANDSRGT-VXGBXAGGSA-N |
| XLogP | 4.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |