C26H29ClN4O4 — CID 166148789
1-(3-chloro-4-methylphenyl)-3-[2-methyl-1-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propyl]urea (PubChem CID 166148789) has the molecular formula C26H29ClN4O4 and a molecular weight of 497.00 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[2-methyl-1-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[2-methyl-1-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propyl]urea |
|---|---|
| PubChem CID | 166148789 |
| Molecular Formula | C26H29ClN4O4 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[2-methyl-1-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propyl]urea |
| SMILES | Cc1ccc(NC(=O)NC(c2ccc3c(c2)CN(C2CCC(=O)N(C)C2=O)C3=O)C(C)C)cc1Cl |
| InChI | InChI=1S/C26H29ClN4O4/c1-14(2)23(29-26(35)28-18-7-5-15(3)20(27)12-18)16-6-8-19-17(11-16)13-31(24(19)33)21-9-10-22(32)30(4)25(21)34/h5-8,11-12,14,21,23H,9-10,13H2,1-4H3,(H2,28,29,35) |
| InChIKey | XQVKYOBNVUVNCW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|