About cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone
cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone (PubChem CID 166150879) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone.
Molecular Properties
| Compound Name | cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone |
| PubChem CID | 166150879 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone |
| SMILES | O=C(C1=CCCC1)N1C[C@@H]2C[C@H]1CN2 |
| InChI | InChI=1S/C11H16N2O/c14-11(8-3-1-2-4-8)13-7-9-5-10(13)6-12-9/h3,9-10,12H,1-2,4-7H2/t9-,10-/m0/s1 |
| InChIKey | ZESJNWYGNLZBDJ-UWVGGRQHSA-N |
| XLogP | 0.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone?
The IUPAC name of cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone (CID 166150879) is cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone.
What is the SMILES notation for cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone?
The canonical SMILES for cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone is O=C(C1=CCCC1)N1C[C@@H]2C[C@H]1CN2.
What is the InChIKey of cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone?
The InChIKey is ZESJNWYGNLZBDJ-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H16N2O/c14-11(8-3-1-2-4-8)13-7-9-5-10(13)6-12-9/h3,9-10,12H,1-2,4-7H2/t9-,10-/m0/s1.
What are the key properties of cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone?
cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone has a molecular weight of 192.26 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone is sourced from PubChem (CID 166150879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).