C15H27BN2O3 — CID 166152262
ethane;2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine (PubChem CID 166152262) has the molecular formula C15H27BN2O3 and a molecular weight of 294.20 g/mol. Its IUPAC name is ethane;2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine.
| Compound Name | ethane;2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 166152262 |
| Molecular Formula | C15H27BN2O3 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | ethane;2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine |
| SMILES | CC.Cc1nn2c(c1B1OC(C)(C)C(C)(C)O1)COCC2 |
| InChI | InChI=1S/C13H21BN2O3.C2H6/c1-9-11(10-8-17-7-6-16(10)15-9)14-18-12(2,3)13(4,5)19-14;1-2/h6-8H2,1-5H3;1-2H3 |
| InChIKey | WGFNJTZGSAQOLZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|