C16H24BNO3 — CID 156612454
4-[2,4,6-trideuterio-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine (PubChem CID 156612454) has the molecular formula C16H24BNO3 and a molecular weight of 292.20 g/mol. Its IUPAC name is 4-[2,4,6-trideuterio-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine.
| Compound Name | 4-[2,4,6-trideuterio-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine |
|---|---|
| PubChem CID | 156612454 |
| Molecular Formula | C16H24BNO3 |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 4-[2,4,6-trideuterio-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine |
| SMILES | [2H]c1cc([2H])c(N2CCOCC2)c([2H])c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H24BNO3/c1-15(2)16(3,4)21-17(20-15)13-6-5-7-14(12-13)18-8-10-19-11-9-18/h5-7,12H,8-11H2,1-4H3/i6D,7D,12D |
| InChIKey | NCJDKFFODGZRRL-DHMPXPLHSA-N |
| XLogP | 1.82 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|