C28H31N5O7 — CID 166152366
tert-butyl 2-[4-[(2,6-dioxopiperidin-3-yl)carbamoyl]-2-methyl-6-(phenylmethoxycarbonylamino)benzimidazol-1-yl]acetate (PubChem CID 166152366) has the molecular formula C28H31N5O7 and a molecular weight of 549.58 g/mol. Its IUPAC name is tert-butyl 2-[4-[(2,6-dioxopiperidin-3-yl)carbamoyl]-2-methyl-6-(phenylmethoxycarbonylamino)benzimidazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[(2,6-dioxopiperidin-3-yl)carbamoyl]-2-methyl-6-(phenylmethoxycarbonylamino)benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 166152366 |
| Molecular Formula | C28H31N5O7 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | tert-butyl 2-[4-[(2,6-dioxopiperidin-3-yl)carbamoyl]-2-methyl-6-(phenylmethoxycarbonylamino)benzimidazol-1-yl]acetate |
| SMILES | Cc1nc2c(C(=O)NC3CCC(=O)NC3=O)cc(NC(=O)OCc3ccccc3)cc2n1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H31N5O7/c1-16-29-24-19(25(36)31-20-10-11-22(34)32-26(20)37)12-18(30-27(38)39-15-17-8-6-5-7-9-17)13-21(24)33(16)14-23(35)40-28(2,3)4/h5-9,12-13,20H,10-11,14-15H2,1-4H3,(H,30,38)(H,31,36)(H,32,34,37) |
| InChIKey | SYAJALULPCRGKV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 157.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|