C20H23BrN4O5 — CID 166152012
tert-butyl 2-[6-bromo-4-[(2,6-dioxopiperidin-3-yl)carbamoyl]-2-methylbenzimidazol-1-yl]acetate (PubChem CID 166152012) has the molecular formula C20H23BrN4O5 and a molecular weight of 479.33 g/mol. Its IUPAC name is tert-butyl 2-[6-bromo-4-[(2,6-dioxopiperidin-3-yl)carbamoyl]-2-methylbenzimidazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[6-bromo-4-[(2,6-dioxopiperidin-3-yl)carbamoyl]-2-methylbenzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 166152012 |
| Molecular Formula | C20H23BrN4O5 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | tert-butyl 2-[6-bromo-4-[(2,6-dioxopiperidin-3-yl)carbamoyl]-2-methylbenzimidazol-1-yl]acetate |
| SMILES | Cc1nc2c(C(=O)NC3CCC(=O)NC3=O)cc(Br)cc2n1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H23BrN4O5/c1-10-22-17-12(18(28)23-13-5-6-15(26)24-19(13)29)7-11(21)8-14(17)25(10)9-16(27)30-20(2,3)4/h7-8,13H,5-6,9H2,1-4H3,(H,23,28)(H,24,26,29) |
| InChIKey | RLCTVPIPRITQKL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|