C21H25N3O5 — CID 166154286
3-[6-[(3R,6S)-1-acetyl-6-methylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166154286) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-[6-[(3R,6S)-1-acetyl-6-methylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(3R,6S)-1-acetyl-6-methylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166154286 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 3-[6-[(3R,6S)-1-acetyl-6-methylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(=O)N1C[C@H](Oc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)CC[C@@H]1C |
| InChI | InChI=1S/C21H25N3O5/c1-12-3-4-16(11-23(12)13(2)25)29-15-5-6-17-14(9-15)10-24(21(17)28)18-7-8-19(26)22-20(18)27/h5-6,9,12,16,18H,3-4,7-8,10-11H2,1-2H3,(H,22,26,27)/t12-,16+,18?/m0/s1 |
| InChIKey | SVTVVARNFMAOML-NMZJCNHASA-N |
| XLogP | 1.23 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|