C23H21F3N4O4 — CID 166154806
5-(2-nitrophenyl)-N-(2-pyrrolidin-1-ylethyl)-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 166154806) has the molecular formula C23H21F3N4O4 and a molecular weight of 474.44 g/mol. Its IUPAC name is 5-(2-nitrophenyl)-N-(2-pyrrolidin-1-ylethyl)-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 5-(2-nitrophenyl)-N-(2-pyrrolidin-1-ylethyl)-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 166154806 |
| Molecular Formula | C23H21F3N4O4 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 5-(2-nitrophenyl)-N-(2-pyrrolidin-1-ylethyl)-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCN1CCCC1)c1nc(-c2ccc(C(F)(F)F)cc2)oc1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H21F3N4O4/c24-23(25,26)16-9-7-15(8-10-16)22-28-19(21(31)27-11-14-29-12-3-4-13-29)20(34-22)17-5-1-2-6-18(17)30(32)33/h1-2,5-10H,3-4,11-14H2,(H,27,31) |
| InChIKey | ZLCCRDUZBZOKMA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|