C24H23F3N4O4 — CID 166154903
5-(2-nitrophenyl)-N-(3-pyrrolidin-1-ylpropyl)-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 166154903) has the molecular formula C24H23F3N4O4 and a molecular weight of 488.47 g/mol. Its IUPAC name is 5-(2-nitrophenyl)-N-(3-pyrrolidin-1-ylpropyl)-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 5-(2-nitrophenyl)-N-(3-pyrrolidin-1-ylpropyl)-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 166154903 |
| Molecular Formula | C24H23F3N4O4 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 5-(2-nitrophenyl)-N-(3-pyrrolidin-1-ylpropyl)-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCCC1)c1nc(-c2ccc(C(F)(F)F)cc2)oc1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H23F3N4O4/c25-24(26,27)17-10-8-16(9-11-17)23-29-20(22(32)28-12-5-15-30-13-3-4-14-30)21(35-23)18-6-1-2-7-19(18)31(33)34/h1-2,6-11H,3-5,12-15H2,(H,28,32) |
| InChIKey | OOLXYSJHYINCBA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|