C24H25IN4O3S — CID 166156064
ethane;[5-[5-formyl-3-(3-methylphenyl)pyrazol-1-yl]-7-morpholin-4-ylfuro[3,2-b]pyridin-2-yl] thiohypoiodite (PubChem CID 166156064) has the molecular formula C24H25IN4O3S and a molecular weight of 576.46 g/mol. Its IUPAC name is ethane;[5-[5-formyl-3-(3-methylphenyl)pyrazol-1-yl]-7-morpholin-4-ylfuro[3,2-b]pyridin-2-yl] thiohypoiodite.
| Compound Name | ethane;[5-[5-formyl-3-(3-methylphenyl)pyrazol-1-yl]-7-morpholin-4-ylfuro[3,2-b]pyridin-2-yl] thiohypoiodite |
|---|---|
| PubChem CID | 166156064 |
| Molecular Formula | C24H25IN4O3S |
| Molecular Weight | 576.46 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | ethane;[5-[5-formyl-3-(3-methylphenyl)pyrazol-1-yl]-7-morpholin-4-ylfuro[3,2-b]pyridin-2-yl] thiohypoiodite |
| SMILES | CC.Cc1cccc(-c2cc(C=O)n(-c3cc(N4CCOCC4)c4oc(SI)cc4n3)n2)c1 |
| InChI | InChI=1S/C22H19IN4O3S.C2H6/c1-14-3-2-4-15(9-14)17-10-16(13-28)27(25-17)20-12-19(26-5-7-29-8-6-26)22-18(24-20)11-21(30-22)31-23;1-2/h2-4,9-13H,5-8H2,1H3;1-2H3 |
| InChIKey | TZPVITDNZQGJLZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.46 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|