C27H33ClN6O3 — CID 172568572
1-[2-(chloromethyl)-3-ethyl-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-yl]-3-(3-methylphenyl)pyrazole-5-carbaldehyde;methoxyethane (PubChem CID 172568572) has the molecular formula C27H33ClN6O3 and a molecular weight of 525.05 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-3-ethyl-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-yl]-3-(3-methylphenyl)pyrazole-5-carbaldehyde;methoxyethane.
| Compound Name | 1-[2-(chloromethyl)-3-ethyl-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-yl]-3-(3-methylphenyl)pyrazole-5-carbaldehyde;methoxyethane |
|---|---|
| PubChem CID | 172568572 |
| Molecular Formula | C27H33ClN6O3 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 1-[2-(chloromethyl)-3-ethyl-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-yl]-3-(3-methylphenyl)pyrazole-5-carbaldehyde;methoxyethane |
| SMILES | CCOC.CCn1c(CCl)nc2c(N3CCOCC3)cc(-n3nc(-c4cccc(C)c4)cc3C=O)nc21 |
| InChI | InChI=1S/C24H25ClN6O2.C3H8O/c1-3-30-22(14-25)26-23-20(29-7-9-33-10-8-29)13-21(27-24(23)30)31-18(15-32)12-19(28-31)17-6-4-5-16(2)11-17;1-3-4-2/h4-6,11-13,15H,3,7-10,14H2,1-2H3;3H2,1-2H3 |
| InChIKey | FHTVFISLWKNNAF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 87.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|