C24H28N6O5 — CID 172568578
ethyl 1-[6-(ethylamino)-4-morpholin-4-yl-5-nitro-2-pyridinyl]-3-(3-methylphenyl)pyrazole-5-carboxylate (PubChem CID 172568578) has the molecular formula C24H28N6O5 and a molecular weight of 480.53 g/mol. Its IUPAC name is ethyl 1-[6-(ethylamino)-4-morpholin-4-yl-5-nitro-2-pyridinyl]-3-(3-methylphenyl)pyrazole-5-carboxylate.
| Compound Name | ethyl 1-[6-(ethylamino)-4-morpholin-4-yl-5-nitro-2-pyridinyl]-3-(3-methylphenyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 172568578 |
| Molecular Formula | C24H28N6O5 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | ethyl 1-[6-(ethylamino)-4-morpholin-4-yl-5-nitro-2-pyridinyl]-3-(3-methylphenyl)pyrazole-5-carboxylate |
| SMILES | CCNc1nc(-n2nc(-c3cccc(C)c3)cc2C(=O)OCC)cc(N2CCOCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H28N6O5/c1-4-25-23-22(30(32)33)19(28-9-11-34-12-10-28)15-21(26-23)29-20(24(31)35-5-2)14-18(27-29)17-8-6-7-16(3)13-17/h6-8,13-15H,4-5,9-12H2,1-3H3,(H,25,26) |
| InChIKey | VCSCFXDSZNQHOA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 124.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|