C22H23N5O7S — CID 25336960
ethyl 3-(4-morpholin-4-ylphenyl)-1-(2-nitro-4-sulfamoylphenyl)pyrazole-5-carboxylate (PubChem CID 25336960) has the molecular formula C22H23N5O7S and a molecular weight of 501.52 g/mol. Its IUPAC name is ethyl 3-(4-morpholin-4-ylphenyl)-1-(2-nitro-4-sulfamoylphenyl)pyrazole-5-carboxylate.
| Compound Name | ethyl 3-(4-morpholin-4-ylphenyl)-1-(2-nitro-4-sulfamoylphenyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 25336960 |
| Molecular Formula | C22H23N5O7S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | ethyl 3-(4-morpholin-4-ylphenyl)-1-(2-nitro-4-sulfamoylphenyl)pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(N3CCOCC3)cc2)nn1-c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23N5O7S/c1-2-34-22(28)21-14-18(15-3-5-16(6-4-15)25-9-11-33-12-10-25)24-26(21)19-8-7-17(35(23,31)32)13-20(19)27(29)30/h3-8,13-14H,2,9-12H2,1H3,(H2,23,31,32) |
| InChIKey | KZAWFQGWFKBEPU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 159.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|