C23H21N5O8 — CID 91062694
carbamoyl 6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-3-oxopyridazine-4-carboxylate (PubChem CID 91062694) has the molecular formula C23H21N5O8 and a molecular weight of 495.45 g/mol. Its IUPAC name is carbamoyl 6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-3-oxopyridazine-4-carboxylate.
| Compound Name | carbamoyl 6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-3-oxopyridazine-4-carboxylate |
|---|---|
| PubChem CID | 91062694 |
| Molecular Formula | C23H21N5O8 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | carbamoyl 6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-3-oxopyridazine-4-carboxylate |
| SMILES | COc1cccc(-c2cc(C(=O)OC(N)=O)c(=O)n(-c3cc(N4CCOCC4)ccc3[N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C23H21N5O8/c1-34-16-4-2-3-14(11-16)18-13-17(22(30)36-23(24)31)21(29)27(25-18)20-12-15(5-6-19(20)28(32)33)26-7-9-35-10-8-26/h2-6,11-13H,7-10H2,1H3,(H2,24,31) |
| InChIKey | RTDXPOYEVYMDIJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 169.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|