C29H28N4O5 — CID 69180398
6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-4-(2-phenylethyl)pyridazin-3-one (PubChem CID 69180398) has the molecular formula C29H28N4O5 and a molecular weight of 512.57 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-4-(2-phenylethyl)pyridazin-3-one.
| Compound Name | 6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-4-(2-phenylethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 69180398 |
| Molecular Formula | C29H28N4O5 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-4-(2-phenylethyl)pyridazin-3-one |
| SMILES | COc1cccc(-c2cc(CCc3ccccc3)c(=O)n(-c3cc(N4CCOCC4)ccc3[N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C29H28N4O5/c1-37-25-9-5-8-22(18-25)26-19-23(11-10-21-6-3-2-4-7-21)29(34)32(30-26)28-20-24(12-13-27(28)33(35)36)31-14-16-38-17-15-31/h2-9,12-13,18-20H,10-11,14-17H2,1H3 |
| InChIKey | DBBHIWGSHXQQNG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|