C26H30N6O5 — CID 69162237
2-[5-(4-acetylpiperazin-1-yl)-2-nitrophenyl]-4-[ethyl(methyl)amino]-6-(3-methoxyphenyl)pyridazin-3-one (PubChem CID 69162237) has the molecular formula C26H30N6O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is 2-[5-(4-acetylpiperazin-1-yl)-2-nitrophenyl]-4-[ethyl(methyl)amino]-6-(3-methoxyphenyl)pyridazin-3-one.
| Compound Name | 2-[5-(4-acetylpiperazin-1-yl)-2-nitrophenyl]-4-[ethyl(methyl)amino]-6-(3-methoxyphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 69162237 |
| Molecular Formula | C26H30N6O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 2-[5-(4-acetylpiperazin-1-yl)-2-nitrophenyl]-4-[ethyl(methyl)amino]-6-(3-methoxyphenyl)pyridazin-3-one |
| SMILES | CCN(C)c1cc(-c2cccc(OC)c2)nn(-c2cc(N3CCN(C(C)=O)CC3)ccc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C26H30N6O5/c1-5-28(3)25-17-22(19-7-6-8-21(15-19)37-4)27-31(26(25)34)24-16-20(9-10-23(24)32(35)36)30-13-11-29(12-14-30)18(2)33/h6-10,15-17H,5,11-14H2,1-4H3 |
| InChIKey | PTUMPAVVVFCOKP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 114.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|