C26H28N4O7 — CID 69161261
2-methylpropyl 6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-3-oxopyridazine-4-carboxylate (PubChem CID 69161261) has the molecular formula C26H28N4O7 and a molecular weight of 508.53 g/mol. Its IUPAC name is 2-methylpropyl 6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-3-oxopyridazine-4-carboxylate.
| Compound Name | 2-methylpropyl 6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-3-oxopyridazine-4-carboxylate |
|---|---|
| PubChem CID | 69161261 |
| Molecular Formula | C26H28N4O7 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 2-methylpropyl 6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-3-oxopyridazine-4-carboxylate |
| SMILES | COc1cccc(-c2cc(C(=O)OCC(C)C)c(=O)n(-c3cc(N4CCOCC4)ccc3[N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C26H28N4O7/c1-17(2)16-37-26(32)21-15-22(18-5-4-6-20(13-18)35-3)27-29(25(21)31)24-14-19(7-8-23(24)30(33)34)28-9-11-36-12-10-28/h4-8,13-15,17H,9-12,16H2,1-3H3 |
| InChIKey | OANDSNDHPQMOPD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 126.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|