C24H25N5O7 — CID 69161797
2-[[6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-3-oxopyridazin-4-yl]-methylamino]acetic acid (PubChem CID 69161797) has the molecular formula C24H25N5O7 and a molecular weight of 495.49 g/mol. Its IUPAC name is 2-[[6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-3-oxopyridazin-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-3-oxopyridazin-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 69161797 |
| Molecular Formula | C24H25N5O7 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 2-[[6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)-3-oxopyridazin-4-yl]-methylamino]acetic acid |
| SMILES | COc1cccc(-c2cc(N(C)CC(=O)O)c(=O)n(-c3cc(N4CCOCC4)ccc3[N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C24H25N5O7/c1-26(15-23(30)31)22-14-19(16-4-3-5-18(12-16)35-2)25-28(24(22)32)21-13-17(6-7-20(21)29(33)34)27-8-10-36-11-9-27/h3-7,12-14H,8-11,15H2,1-2H3,(H,30,31) |
| InChIKey | YNPRKJAOVVUZTE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|