C25H29N5O5 — CID 69160744
4-(tert-butylamino)-6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)pyridazin-3-one (PubChem CID 69160744) has the molecular formula C25H29N5O5 and a molecular weight of 479.54 g/mol. Its IUPAC name is 4-(tert-butylamino)-6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)pyridazin-3-one.
| Compound Name | 4-(tert-butylamino)-6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 69160744 |
| Molecular Formula | C25H29N5O5 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 4-(tert-butylamino)-6-(3-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)pyridazin-3-one |
| SMILES | COc1cccc(-c2cc(NC(C)(C)C)c(=O)n(-c3cc(N4CCOCC4)ccc3[N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C25H29N5O5/c1-25(2,3)26-21-16-20(17-6-5-7-19(14-17)34-4)27-29(24(21)31)23-15-18(8-9-22(23)30(32)33)28-10-12-35-13-11-28/h5-9,14-16,26H,10-13H2,1-4H3 |
| InChIKey | ZYDTVUUWSINTBH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|