C25H28N6O5 — CID 69160542
4-[ethyl(methyl)amino]-6-(3-methoxyphenyl)-2-[5-(4-methyl-3-oxopiperazin-1-yl)-2-nitrophenyl]pyridazin-3-one (PubChem CID 69160542) has the molecular formula C25H28N6O5 and a molecular weight of 492.54 g/mol. Its IUPAC name is 4-[ethyl(methyl)amino]-6-(3-methoxyphenyl)-2-[5-(4-methyl-3-oxopiperazin-1-yl)-2-nitrophenyl]pyridazin-3-one.
| Compound Name | 4-[ethyl(methyl)amino]-6-(3-methoxyphenyl)-2-[5-(4-methyl-3-oxopiperazin-1-yl)-2-nitrophenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 69160542 |
| Molecular Formula | C25H28N6O5 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 4-[ethyl(methyl)amino]-6-(3-methoxyphenyl)-2-[5-(4-methyl-3-oxopiperazin-1-yl)-2-nitrophenyl]pyridazin-3-one |
| SMILES | CCN(C)c1cc(-c2cccc(OC)c2)nn(-c2cc(N3CCN(C)C(=O)C3)ccc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C25H28N6O5/c1-5-27(2)23-15-20(17-7-6-8-19(13-17)36-4)26-30(25(23)33)22-14-18(9-10-21(22)31(34)35)29-12-11-28(3)24(32)16-29/h6-10,13-15H,5,11-12,16H2,1-4H3 |
| InChIKey | VPRDDCOPOMYGAH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 114.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|