C25H22N6O5 — CID 44512179
N'-hydroxy-3-[3-(5-morpholin-4-yl-2-nitrophenyl)-4-oxophthalazin-1-yl]benzenecarboximidamide (PubChem CID 44512179) has the molecular formula C25H22N6O5 and a molecular weight of 486.49 g/mol. Its IUPAC name is N'-hydroxy-3-[3-(5-morpholin-4-yl-2-nitrophenyl)-4-oxophthalazin-1-yl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-3-[3-(5-morpholin-4-yl-2-nitrophenyl)-4-oxophthalazin-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 44512179 |
| Molecular Formula | C25H22N6O5 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N'-hydroxy-3-[3-(5-morpholin-4-yl-2-nitrophenyl)-4-oxophthalazin-1-yl]benzenecarboximidamide |
| SMILES | N/C(=N/O)c1cccc(-c2nn(-c3cc(N4CCOCC4)ccc3[N+](=O)[O-])c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C25H22N6O5/c26-24(28-33)17-5-3-4-16(14-17)23-19-6-1-2-7-20(19)25(32)30(27-23)22-15-18(8-9-21(22)31(34)35)29-10-12-36-13-11-29/h1-9,14-15,33H,10-13H2,(H2,26,28) |
| InChIKey | GPVPIKNEOPVVHB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 149.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|