C24H19BN4O4 — CID 89246728
CID 89246728 (PubChem CID 89246728) has the molecular formula C24H19BN4O4 and a molecular weight of 438.25 g/mol.
| Compound Name | CID 89246728 |
|---|---|
| PubChem CID | 89246728 |
| Molecular Formula | C24H19BN4O4 |
| Molecular Weight | 438.25 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(-c2nn(-c3cc(N4CCOCC4)ccc3[N+](=O)[O-])c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C24H19BN4O4/c25-17-5-3-4-16(14-17)23-19-6-1-2-7-20(19)24(30)28(26-23)22-15-18(8-9-21(22)29(31)32)27-10-12-33-13-11-27/h1-9,14-15H,10-13H2 |
| InChIKey | PQZFMMFTWSXHBQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|