C25H19N5O5 — CID 69160521
4-(1,3-benzoxazol-5-yl)-2-(5-morpholin-4-yl-2-nitrophenyl)phthalazin-1-one (PubChem CID 69160521) has the molecular formula C25H19N5O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-5-yl)-2-(5-morpholin-4-yl-2-nitrophenyl)phthalazin-1-one.
| Compound Name | 4-(1,3-benzoxazol-5-yl)-2-(5-morpholin-4-yl-2-nitrophenyl)phthalazin-1-one |
|---|---|
| PubChem CID | 69160521 |
| Molecular Formula | C25H19N5O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 4-(1,3-benzoxazol-5-yl)-2-(5-morpholin-4-yl-2-nitrophenyl)phthalazin-1-one |
| SMILES | O=c1c2ccccc2c(-c2ccc3ocnc3c2)nn1-c1cc(N2CCOCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H19N5O5/c31-25-19-4-2-1-3-18(19)24(16-5-8-23-20(13-16)26-15-35-23)27-29(25)22-14-17(6-7-21(22)30(32)33)28-9-11-34-12-10-28/h1-8,13-15H,9-12H2 |
| InChIKey | LPESDTJHTHHOLT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 116.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|