C29H23N5O5 — CID 69161624
4-[3-ethenyl-5-(1,3-oxazol-5-yl)phenyl]-2-(5-morpholin-4-yl-2-nitrophenyl)phthalazin-1-one (PubChem CID 69161624) has the molecular formula C29H23N5O5 and a molecular weight of 521.53 g/mol. Its IUPAC name is 4-[3-ethenyl-5-(1,3-oxazol-5-yl)phenyl]-2-(5-morpholin-4-yl-2-nitrophenyl)phthalazin-1-one.
| Compound Name | 4-[3-ethenyl-5-(1,3-oxazol-5-yl)phenyl]-2-(5-morpholin-4-yl-2-nitrophenyl)phthalazin-1-one |
|---|---|
| PubChem CID | 69161624 |
| Molecular Formula | C29H23N5O5 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 4-[3-ethenyl-5-(1,3-oxazol-5-yl)phenyl]-2-(5-morpholin-4-yl-2-nitrophenyl)phthalazin-1-one |
| SMILES | C=Cc1cc(-c2cnco2)cc(-c2nn(-c3cc(N4CCOCC4)ccc3[N+](=O)[O-])c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C29H23N5O5/c1-2-19-13-20(27-17-30-18-39-27)15-21(14-19)28-23-5-3-4-6-24(23)29(35)33(31-28)26-16-22(7-8-25(26)34(36)37)32-9-11-38-12-10-32/h2-8,13-18H,1,9-12H2 |
| InChIKey | KJWWVFJSLWMIFR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 116.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|