C25H21N5O6 — CID 87717921
N-hydroxy-3-[3-(5-morpholin-4-yl-2-nitrophenyl)-4-oxophthalazin-1-yl]benzamide (PubChem CID 87717921) has the molecular formula C25H21N5O6 and a molecular weight of 487.47 g/mol. Its IUPAC name is N-hydroxy-3-[3-(5-morpholin-4-yl-2-nitrophenyl)-4-oxophthalazin-1-yl]benzamide.
| Compound Name | N-hydroxy-3-[3-(5-morpholin-4-yl-2-nitrophenyl)-4-oxophthalazin-1-yl]benzamide |
|---|---|
| PubChem CID | 87717921 |
| Molecular Formula | C25H21N5O6 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | N-hydroxy-3-[3-(5-morpholin-4-yl-2-nitrophenyl)-4-oxophthalazin-1-yl]benzamide |
| SMILES | O=C(NO)c1cccc(-c2nn(-c3cc(N4CCOCC4)ccc3[N+](=O)[O-])c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C25H21N5O6/c31-24(27-33)17-5-3-4-16(14-17)23-19-6-1-2-7-20(19)25(32)29(26-23)22-15-18(8-9-21(22)30(34)35)28-10-12-36-13-11-28/h1-9,14-15,33H,10-13H2,(H,27,31) |
| InChIKey | OWDRENPEXAGDSH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|