C31H25N5O4 — CID 69160195
4-(3-ethenyl-5-pyridin-2-ylphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)phthalazin-1-one (PubChem CID 69160195) has the molecular formula C31H25N5O4 and a molecular weight of 531.57 g/mol. Its IUPAC name is 4-(3-ethenyl-5-pyridin-2-ylphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)phthalazin-1-one.
| Compound Name | 4-(3-ethenyl-5-pyridin-2-ylphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)phthalazin-1-one |
|---|---|
| PubChem CID | 69160195 |
| Molecular Formula | C31H25N5O4 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 4-(3-ethenyl-5-pyridin-2-ylphenyl)-2-(5-morpholin-4-yl-2-nitrophenyl)phthalazin-1-one |
| SMILES | C=Cc1cc(-c2ccccn2)cc(-c2nn(-c3cc(N4CCOCC4)ccc3[N+](=O)[O-])c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C31H25N5O4/c1-2-21-17-22(27-9-5-6-12-32-27)19-23(18-21)30-25-7-3-4-8-26(25)31(37)35(33-30)29-20-24(10-11-28(29)36(38)39)34-13-15-40-16-14-34/h2-12,17-20H,1,13-16H2 |
| InChIKey | XWTFYUMGAZHUNL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|