C28H30N6O5 — CID 172568305
N-[(3,5-dimethoxyphenyl)methyl]-6-[3-(3-methylphenyl)pyrazol-1-yl]-4-morpholin-4-yl-3-nitropyridin-2-amine (PubChem CID 172568305) has the molecular formula C28H30N6O5 and a molecular weight of 530.59 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-6-[3-(3-methylphenyl)pyrazol-1-yl]-4-morpholin-4-yl-3-nitropyridin-2-amine.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-6-[3-(3-methylphenyl)pyrazol-1-yl]-4-morpholin-4-yl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 172568305 |
| Molecular Formula | C28H30N6O5 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-6-[3-(3-methylphenyl)pyrazol-1-yl]-4-morpholin-4-yl-3-nitropyridin-2-amine |
| SMILES | COc1cc(CNc2nc(-n3ccc(-c4cccc(C)c4)n3)cc(N3CCOCC3)c2[N+](=O)[O-])cc(OC)c1 |
| InChI | InChI=1S/C28H30N6O5/c1-19-5-4-6-21(13-19)24-7-8-33(31-24)26-17-25(32-9-11-39-12-10-32)27(34(35)36)28(30-26)29-18-20-14-22(37-2)16-23(15-20)38-3/h4-8,13-17H,9-12,18H2,1-3H3,(H,29,30) |
| InChIKey | PAXOZUDNDVAJOX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|