C28H27B4N7O4 — CID 172574534
CID 172574534 (PubChem CID 172574534) has the molecular formula C28H27B4N7O4 and a molecular weight of 568.82 g/mol.
| Compound Name | CID 172574534 |
|---|---|
| PubChem CID | 172574534 |
| Molecular Formula | C28H27B4N7O4 |
| Molecular Weight | 568.82 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N(Cc1cc(-c2cc3nc(-n4ccc(-c5cccc(C)c5)n4)cc(N4CCOCC4)c3o2)nn1C)C([B])(O)O |
| InChI | InChI=1S/C28H27B4N7O4/c1-17-4-3-5-18(12-17)20-6-7-38(35-20)25-15-23(37-8-10-42-11-9-37)26-22(33-25)14-24(43-26)21-13-19(36(2)34-21)16-39(27(29,30)31)28(32,40)41/h3-7,12-15,40-41H,8-11,16H2,1-2H3 |
| InChIKey | ZXCSLCBKXATRDG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.82 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|