C34H44BN4O3 — CID 166156254
CID 166156254 (PubChem CID 166156254) has the molecular formula C34H44BN4O3 and a molecular weight of 567.56 g/mol.
| Compound Name | CID 166156254 |
|---|---|
| PubChem CID | 166156254 |
| Molecular Formula | C34H44BN4O3 |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.35 |
| IUPAC Name | — |
| SMILES | CCCCC(=O)C(C)C.CCCCC(=O)C1=Cc2nc(-n3ccc(-c4cccc(C)c4)n3)cc(N3CCOCC3)c2[B]1 |
| InChI | InChI=1S/C26H28BN4O2.C8H16O/c1-3-4-8-24(32)20-16-22-26(27-20)23(30-11-13-33-14-12-30)17-25(28-22)31-10-9-21(29-31)19-7-5-6-18(2)15-19;1-4-5-6-8(9)7(2)3/h5-7,9-10,15-17H,3-4,8,11-14H2,1-2H3;7H,4-6H2,1-3H3 |
| InChIKey | HVOGACWCLXGYPK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|