C14H10ClF3N2O — CID 166161513
1-(2-chlorophenyl)-6-(trifluoromethoxy)-2,3-dihydroindazole (PubChem CID 166161513) has the molecular formula C14H10ClF3N2O and a molecular weight of 314.69 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-6-(trifluoromethoxy)-2,3-dihydroindazole.
| Compound Name | 1-(2-chlorophenyl)-6-(trifluoromethoxy)-2,3-dihydroindazole |
|---|---|
| PubChem CID | 166161513 |
| Molecular Formula | C14H10ClF3N2O |
| Molecular Weight | 314.69 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 1-(2-chlorophenyl)-6-(trifluoromethoxy)-2,3-dihydroindazole |
| SMILES | FC(F)(F)Oc1ccc2c(c1)N(c1ccccc1Cl)NC2 |
| InChI | InChI=1S/C14H10ClF3N2O/c15-11-3-1-2-4-12(11)20-13-7-10(21-14(16,17)18)6-5-9(13)8-19-20/h1-7,19H,8H2 |
| InChIKey | JJJLIXIXCDNQSO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.69 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |